C13H27N3O2S3 — CID 43077015
1-(3-methylsulfanylpropyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea (PubChem CID 43077015) has the molecular formula C13H27N3O2S3 and a molecular weight of 353.58 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 43077015 |
| Molecular Formula | C13H27N3O2S3 |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea |
| SMILES | CCCS(=O)(=O)N1CCC(NC(=S)NCCCSC)CC1 |
| InChI | InChI=1S/C13H27N3O2S3/c1-3-11-21(17,18)16-8-5-12(6-9-16)15-13(19)14-7-4-10-20-2/h12H,3-11H2,1-2H3,(H2,14,15,19) |
| InChIKey | NOFZOVIHKPNXOF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|