C16H27N5O2S3 — CID 43076706
1-(3-methylsulfanylpropyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea (PubChem CID 43076706) has the molecular formula C16H27N5O2S3 and a molecular weight of 417.63 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea |
|---|---|
| PubChem CID | 43076706 |
| Molecular Formula | C16H27N5O2S3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea |
| SMILES | CSCCCNC(=S)NCCS(=O)(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C16H27N5O2S3/c1-25-13-4-7-18-16(24)19-8-14-26(22,23)21-11-9-20(10-12-21)15-5-2-3-6-17-15/h2-3,5-6H,4,7-14H2,1H3,(H2,18,19,24) |
| InChIKey | KAEJBCKMMPFGHT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|