C20H27N5O2S2 — CID 43076716
1-(4-ethylphenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea (PubChem CID 43076716) has the molecular formula C20H27N5O2S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea |
|---|---|
| PubChem CID | 43076716 |
| Molecular Formula | C20H27N5O2S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]thiourea |
| SMILES | CCc1ccc(NC(=S)NCCS(=O)(=O)N2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C20H27N5O2S2/c1-2-17-6-8-18(9-7-17)23-20(28)22-11-16-29(26,27)25-14-12-24(13-15-25)19-5-3-4-10-21-19/h3-10H,2,11-16H2,1H3,(H2,22,23,28) |
| InChIKey | GDQURTHLRUWPGV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|