C17H21N5O4S — CID 60512015
1-oxido-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridin-1-ium-2-carboxamide (PubChem CID 60512015) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is 1-oxido-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridin-1-ium-2-carboxamide.
| Compound Name | 1-oxido-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 60512015 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-oxido-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridin-1-ium-2-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(c2ccccn2)CC1)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C17H21N5O4S/c23-17(15-5-2-4-9-22(15)24)19-8-14-27(25,26)21-12-10-20(11-13-21)16-6-1-3-7-18-16/h1-7,9H,8,10-14H2,(H,19,23) |
| InChIKey | ILIQAUHVYPYQSF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|