C23H25N5O3S2 — CID 55692390
2-phenylsulfanyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridine-3-carboxamide (PubChem CID 55692390) has the molecular formula C23H25N5O3S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridine-3-carboxamide.
| Compound Name | 2-phenylsulfanyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55692390 |
| Molecular Formula | C23H25N5O3S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-phenylsulfanyl-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(c2ccccn2)CC1)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C23H25N5O3S2/c29-22(20-9-6-12-26-23(20)32-19-7-2-1-3-8-19)25-13-18-33(30,31)28-16-14-27(15-17-28)21-10-4-5-11-24-21/h1-12H,13-18H2,(H,25,29) |
| InChIKey | IVZDUXKRAWMLCH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |