C21H28N4O5S — CID 42438465
2,3-dimethoxy-N-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylpropyl]benzamide (PubChem CID 42438465) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylpropyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylpropyl]benzamide |
|---|---|
| PubChem CID | 42438465 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2,3-dimethoxy-N-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylpropyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCCS(=O)(=O)N2CCN(c3ccccn3)CC2)c1OC |
| InChI | InChI=1S/C21H28N4O5S/c1-29-18-8-5-7-17(20(18)30-2)21(26)23-11-6-16-31(27,28)25-14-12-24(13-15-25)19-9-3-4-10-22-19/h3-5,7-10H,6,11-16H2,1-2H3,(H,23,26) |
| InChIKey | PRVXPWMJBRSKBN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|