C21H27ClN4O5S — CID 46455832
3-chloro-4-ethoxy-5-methoxy-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]benzamide (PubChem CID 46455832) has the molecular formula C21H27ClN4O5S and a molecular weight of 482.99 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]benzamide |
|---|---|
| PubChem CID | 46455832 |
| Molecular Formula | C21H27ClN4O5S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)NCCS(=O)(=O)N2CCN(c3ccccn3)CC2)cc1OC |
| InChI | InChI=1S/C21H27ClN4O5S/c1-3-31-20-17(22)14-16(15-18(20)30-2)21(27)24-8-13-32(28,29)26-11-9-25(10-12-26)19-6-4-5-7-23-19/h4-7,14-15H,3,8-13H2,1-2H3,(H,24,27) |
| InChIKey | SWDGUKMRZXLVKP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |