C18H29N3O6S — CID 16881351
N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-3,4,5-trimethoxybenzamide (PubChem CID 16881351) has the molecular formula C18H29N3O6S and a molecular weight of 415.51 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16881351 |
| Molecular Formula | C18H29N3O6S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN1CCN(S(=O)(=O)CCNC(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H29N3O6S/c1-5-20-7-9-21(10-8-20)28(23,24)11-6-19-18(22)14-12-15(25-2)17(27-4)16(13-14)26-3/h12-13H,5-11H2,1-4H3,(H,19,22) |
| InChIKey | UZSBBGLTBVQAQG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |