C19H30N2O9S — CID 90481320
oxalic acid;1-propylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 90481320) has the molecular formula C19H30N2O9S and a molecular weight of 462.52 g/mol. Its IUPAC name is oxalic acid;1-propylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | oxalic acid;1-propylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 90481320 |
| Molecular Formula | C19H30N2O9S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | oxalic acid;1-propylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | CCCS(=O)(=O)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H28N2O5S.C2H2O4/c1-5-10-25(20,21)19-8-6-18(7-9-19)13-14-11-15(22-2)17(24-4)16(12-14)23-3;3-1(4)2(5)6/h11-12H,5-10,13H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | WBCYWMRUNQIDDP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|