C18H28N2O9S — CID 2902257
1-ethylsulfonyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 2902257) has the molecular formula C18H28N2O9S and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-ethylsulfonyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 2902257 |
| Molecular Formula | C18H28N2O9S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-ethylsulfonyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | CCS(=O)(=O)N1CCN(Cc2cc(OC)c(OC)cc2OC)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H26N2O5S.C2H2O4/c1-5-24(19,20)18-8-6-17(7-9-18)12-13-10-15(22-3)16(23-4)11-14(13)21-2;3-1(4)2(5)6/h10-11H,5-9,12H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | SURGDLWZVGIABV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|