C20H23BrN2O7S — CID 17366066
1-(benzenesulfonyl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 17366066) has the molecular formula C20H23BrN2O7S and a molecular weight of 515.38 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-(benzenesulfonyl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17366066 |
| Molecular Formula | C20H23BrN2O7S |
| Molecular Weight | 515.38 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1ccc(Br)cc1CN1CCN(S(=O)(=O)c2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H21BrN2O3S.C2H2O4/c1-24-18-8-7-16(19)13-15(18)14-20-9-11-21(12-10-20)25(22,23)17-5-3-2-4-6-17;3-1(4)2(5)6/h2-8,13H,9-12,14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | LKWGKXZIRWKTKJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|