C15H21BrN2O3 — CID 2846055
ethyl 4-[(5-bromo-2-methoxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 2846055) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is ethyl 4-[(5-bromo-2-methoxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(5-bromo-2-methoxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2846055 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | ethyl 4-[(5-bromo-2-methoxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2cc(Br)ccc2OC)CC1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-3-21-15(19)18-8-6-17(7-9-18)11-12-10-13(16)4-5-14(12)20-2/h4-5,10H,3,6-9,11H2,1-2H3 |
| InChIKey | VOVNDISXJONPKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |