C18H20BrN3O2 — CID 1002532
[4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]-pyridin-3-ylmethanone (PubChem CID 1002532) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 1002532 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]-pyridin-3-ylmethanone |
| SMILES | COc1ccc(Br)cc1CN1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C18H20BrN3O2/c1-24-17-5-4-16(19)11-15(17)13-21-7-9-22(10-8-21)18(23)14-3-2-6-20-12-14/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | BLVSNGBZBMAAJV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |