C14H19BrN2O2 — CID 782501
ethyl 4-[(2-bromophenyl)methyl]piperazine-1-carboxylate (PubChem CID 782501) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is ethyl 4-[(2-bromophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2-bromophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 782501 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | ethyl 4-[(2-bromophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-2-19-14(18)17-9-7-16(8-10-17)11-12-5-3-4-6-13(12)15/h3-6H,2,7-11H2,1H3 |
| InChIKey | JDPIRAVLLJXMLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |