C13H18BrN3S — CID 19291665
4-[(2-bromophenyl)methyl]-N-methylpiperazine-1-carbothioamide (PubChem CID 19291665) has the molecular formula C13H18BrN3S and a molecular weight of 328.28 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methyl]-N-methylpiperazine-1-carbothioamide.
| Compound Name | 4-[(2-bromophenyl)methyl]-N-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291665 |
| Molecular Formula | C13H18BrN3S |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-[(2-bromophenyl)methyl]-N-methylpiperazine-1-carbothioamide |
| SMILES | CNC(=S)N1CCN(Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C13H18BrN3S/c1-15-13(18)17-8-6-16(7-9-17)10-11-4-2-3-5-12(11)14/h2-5H,6-10H2,1H3,(H,15,18) |
| InChIKey | ZCKCJIUGYIRBJG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|