C23H26BrN5S — CID 19291667
4-[(2-bromophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide (PubChem CID 19291667) has the molecular formula C23H26BrN5S and a molecular weight of 484.47 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(2-bromophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291667 |
| Molecular Formula | C23H26BrN5S |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 4-[(2-bromophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
| SMILES | Cc1ccccc1Cn1cc(NC(=S)N2CCN(Cc3ccccc3Br)CC2)cn1 |
| InChI | InChI=1S/C23H26BrN5S/c1-18-6-2-3-7-19(18)16-29-17-21(14-25-29)26-23(30)28-12-10-27(11-13-28)15-20-8-4-5-9-22(20)24/h2-9,14,17H,10-13,15-16H2,1H3,(H,26,30) |
| InChIKey | FDBHZAOCXQDVLL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|