C24H29N5S — CID 19289620
4-[(3-methylphenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide (PubChem CID 19289620) has the molecular formula C24H29N5S and a molecular weight of 419.60 g/mol. Its IUPAC name is 4-[(3-methylphenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(3-methylphenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289620 |
| Molecular Formula | C24H29N5S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-[(3-methylphenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
| SMILES | Cc1cccc(CN2CCN(C(=S)Nc3cnn(Cc4ccccc4C)c3)CC2)c1 |
| InChI | InChI=1S/C24H29N5S/c1-19-6-5-8-21(14-19)16-27-10-12-28(13-11-27)24(30)26-23-15-25-29(18-23)17-22-9-4-3-7-20(22)2/h3-9,14-15,18H,10-13,16-17H2,1-2H3,(H,26,30) |
| InChIKey | YMRPQULQAUPZLJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|