C23H27N5S — CID 19574258
4-benzyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide (PubChem CID 19574258) has the molecular formula C23H27N5S and a molecular weight of 405.57 g/mol. Its IUPAC name is 4-benzyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide.
| Compound Name | 4-benzyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574258 |
| Molecular Formula | C23H27N5S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 4-benzyl-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(Cn2cc(NC(=S)N3CCN(Cc4ccccc4)CC3)cn2)cc1 |
| InChI | InChI=1S/C23H27N5S/c1-19-7-9-21(10-8-19)17-28-18-22(15-24-28)25-23(29)27-13-11-26(12-14-27)16-20-5-3-2-4-6-20/h2-10,15,18H,11-14,16-17H2,1H3,(H,25,29) |
| InChIKey | PYBLBDPGWJVXNY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|