C27H31N7S — CID 19291627
N-(1-benzylpyrazol-4-yl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazine-1-carbothioamide (PubChem CID 19291627) has the molecular formula C27H31N7S and a molecular weight of 485.66 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291627 |
| Molecular Formula | C27H31N7S |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN1CCN(C(=S)Nc2cnn(Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C27H31N7S/c1-21-26(22(2)34(30-21)25-11-7-4-8-12-25)20-31-13-15-32(16-14-31)27(35)29-24-17-28-33(19-24)18-23-9-5-3-6-10-23/h3-12,17,19H,13-16,18,20H2,1-2H3,(H,29,35) |
| InChIKey | JKNDKNWILIHVEX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|