C21H26FN7S — CID 19291763
4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide (PubChem CID 19291763) has the molecular formula C21H26FN7S and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291763 |
| Molecular Formula | C21H26FN7S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
| SMILES | Cc1nn(C)cc1CN1CCN(C(=S)Nc2cnn(Cc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C21H26FN7S/c1-16-18(13-26(2)25-16)14-27-7-9-28(10-8-27)21(30)24-20-11-23-29(15-20)12-17-3-5-19(22)6-4-17/h3-6,11,13,15H,7-10,12,14H2,1-2H3,(H,24,30) |
| InChIKey | RICGYHRVXPFGCC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|