C17H22FN5S — CID 19289541
N-(1,5-dimethylpyrazol-4-yl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 19289541) has the molecular formula C17H22FN5S and a molecular weight of 347.46 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-4-yl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(1,5-dimethylpyrazol-4-yl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289541 |
| Molecular Formula | C17H22FN5S |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-(1,5-dimethylpyrazol-4-yl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1c(NC(=S)N2CCN(Cc3ccc(F)cc3)CC2)cnn1C |
| InChI | InChI=1S/C17H22FN5S/c1-13-16(11-19-21(13)2)20-17(24)23-9-7-22(8-10-23)12-14-3-5-15(18)6-4-14/h3-6,11H,7-10,12H2,1-2H3,(H,20,24) |
| InChIKey | IOHWYEMZQFOIMB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|