C17H23N5S — CID 19291500
N-(4-methylphenyl)-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide (PubChem CID 19291500) has the molecular formula C17H23N5S and a molecular weight of 329.47 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-methylphenyl)-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291500 |
| Molecular Formula | C17H23N5S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(4-methylphenyl)-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(Cc3cnn(C)c3)CC2)cc1 |
| InChI | InChI=1S/C17H23N5S/c1-14-3-5-16(6-4-14)19-17(23)22-9-7-21(8-10-22)13-15-11-18-20(2)12-15/h3-6,11-12H,7-10,13H2,1-2H3,(H,19,23) |
| InChIKey | VOULZTSEUXDGSW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|