C17H27N7S — CID 19291545
N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide (PubChem CID 19291545) has the molecular formula C17H27N7S and a molecular weight of 361.52 g/mol. Its IUPAC name is N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291545 |
| Molecular Formula | C17H27N7S |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
| SMILES | CCn1cc(CNC(=S)N2CCN(Cc3cnn(C)c3)CC2)c(C)n1 |
| InChI | InChI=1S/C17H27N7S/c1-4-24-13-16(14(2)20-24)10-18-17(25)23-7-5-22(6-8-23)12-15-9-19-21(3)11-15/h9,11,13H,4-8,10,12H2,1-3H3,(H,18,25) |
| InChIKey | SKEDJJKSRMPKMP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|