C20H29N5S — CID 19293322
4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide (PubChem CID 19293322) has the molecular formula C20H29N5S and a molecular weight of 371.55 g/mol. Its IUPAC name is 4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19293322 |
| Molecular Formula | C20H29N5S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-N-(4-ethylphenyl)piperazine-1-carbothioamide |
| SMILES | CCc1ccc(NC(=S)N2CCN(Cc3cn(CC)nc3C)CC2)cc1 |
| InChI | InChI=1S/C20H29N5S/c1-4-17-6-8-19(9-7-17)21-20(26)24-12-10-23(11-13-24)14-18-15-25(5-2)22-16(18)3/h6-9,15H,4-5,10-14H2,1-3H3,(H,21,26) |
| InChIKey | ZXASTBSNYXHWRS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|