C18H23Cl2N5S — CID 19293335
N-(3,4-dichlorophenyl)-4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide (PubChem CID 19293335) has the molecular formula C18H23Cl2N5S and a molecular weight of 412.39 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19293335 |
| Molecular Formula | C18H23Cl2N5S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
| SMILES | CCn1cc(CN2CCN(C(=S)Nc3ccc(Cl)c(Cl)c3)CC2)c(C)n1 |
| InChI | InChI=1S/C18H23Cl2N5S/c1-3-25-12-14(13(2)22-25)11-23-6-8-24(9-7-23)18(26)21-15-4-5-16(19)17(20)10-15/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,21,26) |
| InChIKey | ZKZLXBBNQILPBF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|