C17H21Cl3N4O2S — CID 22208487
1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine (PubChem CID 22208487) has the molecular formula C17H21Cl3N4O2S and a molecular weight of 451.81 g/mol. Its IUPAC name is 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 22208487 |
| Molecular Formula | C17H21Cl3N4O2S |
| Molecular Weight | 451.81 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
| SMILES | CCn1cc(CN2CCN(S(=O)(=O)c3cc(Cl)c(Cl)cc3Cl)CC2)c(C)n1 |
| InChI | InChI=1S/C17H21Cl3N4O2S/c1-3-23-11-13(12(2)21-23)10-22-4-6-24(7-5-22)27(25,26)17-9-15(19)14(18)8-16(17)20/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | WUGSUAADGXANKS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|