C20H30N4O2S — CID 22208447
1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(4-propylphenyl)sulfonylpiperazine (PubChem CID 22208447) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(4-propylphenyl)sulfonylpiperazine.
| Compound Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(4-propylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 22208447 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-4-(4-propylphenyl)sulfonylpiperazine |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(Cc3cn(CC)nc3C)CC2)cc1 |
| InChI | InChI=1S/C20H30N4O2S/c1-4-6-18-7-9-20(10-8-18)27(25,26)24-13-11-22(12-14-24)15-19-16-23(5-2)21-17(19)3/h7-10,16H,4-6,11-15H2,1-3H3 |
| InChIKey | DHHRMRXHTBFOFB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |