C20H24Cl2N2O2S — CID 22207951
1-[(3,4-dichlorophenyl)methyl]-4-(4-propylphenyl)sulfonylpiperazine (PubChem CID 22207951) has the molecular formula C20H24Cl2N2O2S and a molecular weight of 427.40 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-(4-propylphenyl)sulfonylpiperazine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-(4-propylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 22207951 |
| Molecular Formula | C20H24Cl2N2O2S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-(4-propylphenyl)sulfonylpiperazine |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H24Cl2N2O2S/c1-2-3-16-4-7-18(8-5-16)27(25,26)24-12-10-23(11-13-24)15-17-6-9-19(21)20(22)14-17/h4-9,14H,2-3,10-13,15H2,1H3 |
| InChIKey | RPJKDAVKDJHJSQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |