C17H25Cl2N3O2S — CID 31690530
1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]sulfonylazepane (PubChem CID 31690530) has the molecular formula C17H25Cl2N3O2S and a molecular weight of 406.38 g/mol. Its IUPAC name is 1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]sulfonylazepane.
| Compound Name | 1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]sulfonylazepane |
|---|---|
| PubChem CID | 31690530 |
| Molecular Formula | C17H25Cl2N3O2S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]sulfonylazepane |
| SMILES | O=S(=O)(N1CCCCCC1)N1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25Cl2N3O2S/c18-16-6-5-15(13-17(16)19)14-20-9-11-22(12-10-20)25(23,24)21-7-3-1-2-4-8-21/h5-6,13H,1-4,7-12,14H2 |
| InChIKey | VMDCTFUVMZLCHI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |