C20H24Cl2N2O4S — CID 6734614
1-[(3,4-dichlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonyl-1,4-diazepane (PubChem CID 6734614) has the molecular formula C20H24Cl2N2O4S and a molecular weight of 459.40 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 6734614 |
| Molecular Formula | C20H24Cl2N2O4S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonyl-1,4-diazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCCN(Cc3ccc(Cl)c(Cl)c3)CC2)cc1OC |
| InChI | InChI=1S/C20H24Cl2N2O4S/c1-27-19-7-5-16(13-20(19)28-2)29(25,26)24-9-3-8-23(10-11-24)14-15-4-6-17(21)18(22)12-15/h4-7,12-13H,3,8-11,14H2,1-2H3 |
| InChIKey | JYJCSXNTCGPEEE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |