C20H23N3O4S — CID 9435691
3-[[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile (PubChem CID 9435691) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 9435691 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3cccc(C#N)c3)CC2)cc1OC |
| InChI | InChI=1S/C20H23N3O4S/c1-26-19-7-6-18(13-20(19)27-2)28(24,25)23-10-8-22(9-11-23)15-17-5-3-4-16(12-17)14-21/h3-7,12-13H,8-11,15H2,1-2H3 |
| InChIKey | IAZUCIAILLQUOQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |