C19H23ClN2O4S — CID 9435627
1-[(2-chlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 9435627) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 9435627 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-4-(3,4-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3Cl)CC2)cc1OC |
| InChI | InChI=1S/C19H23ClN2O4S/c1-25-18-8-7-16(13-19(18)26-2)27(23,24)22-11-9-21(10-12-22)14-15-5-3-4-6-17(15)20/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | RWARECZQLNDHEC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |