C18H20F2N2O3S — CID 37498338
1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-[(2-fluorophenyl)methyl]piperazine (PubChem CID 37498338) has the molecular formula C18H20F2N2O3S and a molecular weight of 382.43 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-[(2-fluorophenyl)methyl]piperazine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-[(2-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 37498338 |
| Molecular Formula | C18H20F2N2O3S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-[(2-fluorophenyl)methyl]piperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3F)CC2)cc1F |
| InChI | InChI=1S/C18H20F2N2O3S/c1-25-18-7-6-15(12-17(18)20)26(23,24)22-10-8-21(9-11-22)13-14-4-2-3-5-16(14)19/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | INWPHBFJRBWIGE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |