C12H17FN2O5S2 — CID 110818979
1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-methylsulfonylpiperazine (PubChem CID 110818979) has the molecular formula C12H17FN2O5S2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-methylsulfonylpiperazine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 110818979 |
| Molecular Formula | C12H17FN2O5S2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-4-methylsulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(C)(=O)=O)CC2)cc1F |
| InChI | InChI=1S/C12H17FN2O5S2/c1-20-12-4-3-10(9-11(12)13)22(18,19)15-7-5-14(6-8-15)21(2,16)17/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | PJALWWCIFOCISO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |