C19H22F2N2O6S2 — CID 22332516
1,4-bis[(4-fluoro-3-methoxyphenyl)sulfonyl]-1,4-diazepane (PubChem CID 22332516) has the molecular formula C19H22F2N2O6S2 and a molecular weight of 476.52 g/mol. Its IUPAC name is 1,4-bis[(4-fluoro-3-methoxyphenyl)sulfonyl]-1,4-diazepane.
| Compound Name | 1,4-bis[(4-fluoro-3-methoxyphenyl)sulfonyl]-1,4-diazepane |
|---|---|
| PubChem CID | 22332516 |
| Molecular Formula | C19H22F2N2O6S2 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 1,4-bis[(4-fluoro-3-methoxyphenyl)sulfonyl]-1,4-diazepane |
| SMILES | COc1cc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(F)c(OC)c3)CC2)ccc1F |
| InChI | InChI=1S/C19H22F2N2O6S2/c1-28-18-12-14(4-6-16(18)20)30(24,25)22-8-3-9-23(11-10-22)31(26,27)15-5-7-17(21)19(13-15)29-2/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | CHJPANBUZAAMMF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |