C13H19N3O6S2 — CID 171134280
2-methoxy-5-(4-methylsulfonylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 171134280) has the molecular formula C13H19N3O6S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-methoxy-5-(4-methylsulfonylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | 2-methoxy-5-(4-methylsulfonylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 171134280 |
| Molecular Formula | C13H19N3O6S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2-methoxy-5-(4-methylsulfonylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(C)(=O)=O)CC2)cc1C(N)=O |
| InChI | InChI=1S/C13H19N3O6S2/c1-22-12-4-3-10(9-11(12)13(14)17)24(20,21)16-7-5-15(6-8-16)23(2,18)19/h3-4,9H,5-8H2,1-2H3,(H2,14,17) |
| InChIKey | QNUIQENJSYQZTL-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |