C14H21N3O4S — CID 119983942
5-(4-amino-3-methylpiperidin-1-yl)sulfonyl-2-methoxybenzamide (PubChem CID 119983942) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-(4-amino-3-methylpiperidin-1-yl)sulfonyl-2-methoxybenzamide.
| Compound Name | 5-(4-amino-3-methylpiperidin-1-yl)sulfonyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 119983942 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-(4-amino-3-methylpiperidin-1-yl)sulfonyl-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(N)C(C)C2)cc1C(N)=O |
| InChI | InChI=1S/C14H21N3O4S/c1-9-8-17(6-5-12(9)15)22(19,20)10-3-4-13(21-2)11(7-10)14(16)18/h3-4,7,9,12H,5-6,8,15H2,1-2H3,(H2,16,18) |
| InChIKey | ASYHYCQOMDURBN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |