C15H20N2O6S — CID 146024578
2-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylpiperidin-4-yl]acetic acid (PubChem CID 146024578) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylpiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylpiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 146024578 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylpiperidin-4-yl]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(CC(=O)O)CC2)cc1C(N)=O |
| InChI | InChI=1S/C15H20N2O6S/c1-23-13-3-2-11(9-12(13)15(16)20)24(21,22)17-6-4-10(5-7-17)8-14(18)19/h2-3,9-10H,4-8H2,1H3,(H2,16,20)(H,18,19) |
| InChIKey | TVVWJTQYFIMWJH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |