C18H25N3O6S — CID 146024645
methyl 1-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxylate (PubChem CID 146024645) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is methyl 1-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 146024645 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | methyl 1-[1-(3-carbamoyl-4-methoxyphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C2CN(S(=O)(=O)c3ccc(OC)c(C(N)=O)c3)C2)CC1 |
| InChI | InChI=1S/C18H25N3O6S/c1-26-16-4-3-14(9-15(16)17(19)22)28(24,25)21-10-13(11-21)20-7-5-12(6-8-20)18(23)27-2/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H2,19,22) |
| InChIKey | KYOAFMDAXVCHHO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |