C15H20N4O5S — CID 146024648
2-methoxy-5-[3-(3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylbenzamide (PubChem CID 146024648) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-methoxy-5-[3-(3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylbenzamide.
| Compound Name | 2-methoxy-5-[3-(3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 146024648 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-methoxy-5-[3-(3-oxopiperazin-1-yl)azetidin-1-yl]sulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(N3CCNC(=O)C3)C2)cc1C(N)=O |
| InChI | InChI=1S/C15H20N4O5S/c1-24-13-3-2-11(6-12(13)15(16)21)25(22,23)19-7-10(8-19)18-5-4-17-14(20)9-18/h2-3,6,10H,4-5,7-9H2,1H3,(H2,16,21)(H,17,20) |
| InChIKey | FDFRHFYGFKBRFX-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |