C19H21N7O4S — CID 122339159
2-methoxy-5-[4-(6-pyrazol-1-ylpyridazin-3-yl)piperazin-1-yl]sulfonylbenzamide (PubChem CID 122339159) has the molecular formula C19H21N7O4S and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-methoxy-5-[4-(6-pyrazol-1-ylpyridazin-3-yl)piperazin-1-yl]sulfonylbenzamide.
| Compound Name | 2-methoxy-5-[4-(6-pyrazol-1-ylpyridazin-3-yl)piperazin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 122339159 |
| Molecular Formula | C19H21N7O4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-methoxy-5-[4-(6-pyrazol-1-ylpyridazin-3-yl)piperazin-1-yl]sulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccc(-n4cccn4)nn3)CC2)cc1C(N)=O |
| InChI | InChI=1S/C19H21N7O4S/c1-30-16-4-3-14(13-15(16)19(20)27)31(28,29)25-11-9-24(10-12-25)17-5-6-18(23-22-17)26-8-2-7-21-26/h2-8,13H,9-12H2,1H3,(H2,20,27) |
| InChIKey | IDYBEVAUBSFHOP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |