C14H22ClN3O4S — CID 119979778
2-methoxy-5-[4-(methylamino)piperidin-1-yl]sulfonylbenzamide;hydrochloride (PubChem CID 119979778) has the molecular formula C14H22ClN3O4S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-methoxy-5-[4-(methylamino)piperidin-1-yl]sulfonylbenzamide;hydrochloride.
| Compound Name | 2-methoxy-5-[4-(methylamino)piperidin-1-yl]sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119979778 |
| Molecular Formula | C14H22ClN3O4S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-methoxy-5-[4-(methylamino)piperidin-1-yl]sulfonylbenzamide;hydrochloride |
| SMILES | CNC1CCN(S(=O)(=O)c2ccc(OC)c(C(N)=O)c2)CC1.Cl |
| InChI | InChI=1S/C14H21N3O4S.ClH/c1-16-10-5-7-17(8-6-10)22(19,20)11-3-4-13(21-2)12(9-11)14(15)18;/h3-4,9-10,16H,5-8H2,1-2H3,(H2,15,18);1H |
| InChIKey | IANHBEYZFGWHMI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |