C13H17NO6S — CID 63031833
1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 63031833) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63031833 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)O)C2)cc1OC |
| InChI | InChI=1S/C13H17NO6S/c1-19-11-4-3-10(7-12(11)20-2)21(17,18)14-6-5-9(8-14)13(15)16/h3-4,7,9H,5-6,8H2,1-2H3,(H,15,16) |
| InChIKey | SEHBPEOXYMADRK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |