C19H23N3O6S — CID 9435653
1-(3,4-dimethoxyphenyl)sulfonyl-4-[(2-nitrophenyl)methyl]piperazine (PubChem CID 9435653) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-4-[(2-nitrophenyl)methyl]piperazine.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-[(2-nitrophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 9435653 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-[(2-nitrophenyl)methyl]piperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3[N+](=O)[O-])CC2)cc1OC |
| InChI | InChI=1S/C19H23N3O6S/c1-27-18-8-7-16(13-19(18)28-2)29(25,26)21-11-9-20(10-12-21)14-15-5-3-4-6-17(15)22(23)24/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | AHCKOPNFZQFJDB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|