C21H27ClN2O4S — CID 45366340
1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine (PubChem CID 45366340) has the molecular formula C21H27ClN2O4S and a molecular weight of 438.98 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 45366340 |
| Molecular Formula | C21H27ClN2O4S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3OC(C)C)CC2)cc1Cl |
| InChI | InChI=1S/C21H27ClN2O4S/c1-16(2)28-20-7-5-4-6-17(20)15-23-10-12-24(13-11-23)29(25,26)18-8-9-21(27-3)19(22)14-18/h4-9,14,16H,10-13,15H2,1-3H3 |
| InChIKey | ZIECRDZGRQKKNN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |