C18H30N2O3S — CID 110360184
1-butylsulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine (PubChem CID 110360184) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-butylsulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine.
| Compound Name | 1-butylsulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 110360184 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-butylsulfonyl-4-[(2-propan-2-yloxyphenyl)methyl]piperazine |
| SMILES | CCCCS(=O)(=O)N1CCN(Cc2ccccc2OC(C)C)CC1 |
| InChI | InChI=1S/C18H30N2O3S/c1-4-5-14-24(21,22)20-12-10-19(11-13-20)15-17-8-6-7-9-18(17)23-16(2)3/h6-9,16H,4-5,10-15H2,1-3H3 |
| InChIKey | YFYWAVOVWZONHU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |