C17H26N2O6S — CID 90483955
1-[(2-methylphenyl)methyl]-4-propylsulfonylpiperazine;oxalic acid (PubChem CID 90483955) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-4-propylsulfonylpiperazine;oxalic acid.
| Compound Name | 1-[(2-methylphenyl)methyl]-4-propylsulfonylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 90483955 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-4-propylsulfonylpiperazine;oxalic acid |
| SMILES | CCCS(=O)(=O)N1CCN(Cc2ccccc2C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H24N2O2S.C2H2O4/c1-3-12-20(18,19)17-10-8-16(9-11-17)13-15-7-5-4-6-14(15)2;3-1(4)2(5)6/h4-7H,3,8-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | LIGPXNKMXSKVNL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|