C20H31FN2O2S — CID 155495769
1-[(2-fluorophenyl)methyl]-4-(1-propylsulfonylpiperidin-4-yl)piperidine (PubChem CID 155495769) has the molecular formula C20H31FN2O2S and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-4-(1-propylsulfonylpiperidin-4-yl)piperidine.
| Compound Name | 1-[(2-fluorophenyl)methyl]-4-(1-propylsulfonylpiperidin-4-yl)piperidine |
|---|---|
| PubChem CID | 155495769 |
| Molecular Formula | C20H31FN2O2S |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-4-(1-propylsulfonylpiperidin-4-yl)piperidine |
| SMILES | CCCS(=O)(=O)N1CCC(C2CCN(Cc3ccccc3F)CC2)CC1 |
| InChI | InChI=1S/C20H31FN2O2S/c1-2-15-26(24,25)23-13-9-18(10-14-23)17-7-11-22(12-8-17)16-19-5-3-4-6-20(19)21/h3-6,17-18H,2,7-16H2,1H3 |
| InChIKey | SSZYOYMWSFHJGK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |