C18H25N3O6S — CID 2900301
oxalic acid;3-[(4-propylsulfonylpiperazin-1-yl)methyl]-1H-indole (PubChem CID 2900301) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is oxalic acid;3-[(4-propylsulfonylpiperazin-1-yl)methyl]-1H-indole.
| Compound Name | oxalic acid;3-[(4-propylsulfonylpiperazin-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 2900301 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | oxalic acid;3-[(4-propylsulfonylpiperazin-1-yl)methyl]-1H-indole |
| SMILES | CCCS(=O)(=O)N1CCN(Cc2c[nH]c3ccccc23)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H23N3O2S.C2H2O4/c1-2-11-22(20,21)19-9-7-18(8-10-19)13-14-12-17-16-6-4-3-5-15(14)16;3-1(4)2(5)6/h3-6,12,17H,2,7-11,13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | GDLYDNHFRIWNLE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|