C16H21N3O3S — CID 110804849
1H-indol-3-yl-(4-propylsulfonylpiperazin-1-yl)methanone (PubChem CID 110804849) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1H-indol-3-yl-(4-propylsulfonylpiperazin-1-yl)methanone.
| Compound Name | 1H-indol-3-yl-(4-propylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110804849 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1H-indol-3-yl-(4-propylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCN(C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C16H21N3O3S/c1-2-11-23(21,22)19-9-7-18(8-10-19)16(20)14-12-17-15-6-4-3-5-13(14)15/h3-6,12,17H,2,7-11H2,1H3 |
| InChIKey | VMZOBYDGFGXTSR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |